C12H15ClN4O2S — CID 124617587
(2S)-1-(2-chloro-5-methylphenoxy)-3-(1-methyltetrazol-5-yl)sulfanylpropan-2-ol (PubChem CID 124617587) has the molecular formula C12H15ClN4O2S and a molecular weight of 314.80 g/mol. Its IUPAC name is (2S)-1-(2-chloro-5-methylphenoxy)-3-(1-methyltetrazol-5-yl)sulfanylpropan-2-ol.
| Compound Name | (2S)-1-(2-chloro-5-methylphenoxy)-3-(1-methyltetrazol-5-yl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 124617587 |
| Molecular Formula | C12H15ClN4O2S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2S)-1-(2-chloro-5-methylphenoxy)-3-(1-methyltetrazol-5-yl)sulfanylpropan-2-ol |
| SMILES | Cc1ccc(Cl)c(OC[C@H](O)CSc2nnnn2C)c1 |
| InChI | InChI=1S/C12H15ClN4O2S/c1-8-3-4-10(13)11(5-8)19-6-9(18)7-20-12-14-15-16-17(12)2/h3-5,9,18H,6-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | YRDFASCVBQNZNW-VIFPVBQESA-N |
| XLogP | 1.70 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |