C16H19NO2S — CID 43859408
1-(2,5-dimethylphenoxy)-3-pyridin-2-ylsulfanylpropan-2-ol (PubChem CID 43859408) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-(2,5-dimethylphenoxy)-3-pyridin-2-ylsulfanylpropan-2-ol.
| Compound Name | 1-(2,5-dimethylphenoxy)-3-pyridin-2-ylsulfanylpropan-2-ol |
|---|---|
| PubChem CID | 43859408 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(2,5-dimethylphenoxy)-3-pyridin-2-ylsulfanylpropan-2-ol |
| SMILES | Cc1ccc(C)c(OCC(O)CSc2ccccn2)c1 |
| InChI | InChI=1S/C16H19NO2S/c1-12-6-7-13(2)15(9-12)19-10-14(18)11-20-16-5-3-4-8-17-16/h3-9,14,18H,10-11H2,1-2H3 |
| InChIKey | ZZZSBQHCAITRTC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |