C19H25FN2O3 — CID 124618373
1-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 124618373) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 124618373 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | COCC1=CCN(CC(=O)N2CCO[C@H](c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C19H25FN2O3/c1-24-14-15-6-8-21(9-7-15)13-19(23)22-10-11-25-18(12-22)16-2-4-17(20)5-3-16/h2-6,18H,7-14H2,1H3/t18-/m0/s1 |
| InChIKey | BPCKSRXZVXOQKR-SFHVURJKSA-N |
| XLogP | 2.00 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|