C16H26ClN3O2 — CID 124619404
1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine (PubChem CID 124619404) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine.
| Compound Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine |
|---|---|
| PubChem CID | 124619404 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[(4-chloro-1-methylpyrazol-5-yl)methyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine |
| SMILES | Cn1ncc(Cl)c1CN1CCC(OC[C@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C16H26ClN3O2/c1-19-16(15(17)10-18-19)11-20-7-5-13(6-8-20)22-12-14-4-2-3-9-21-14/h10,13-14H,2-9,11-12H2,1H3/t14-/m1/s1 |
| InChIKey | IOARQAGIUIJHCX-CQSZACIVSA-N |
| XLogP | 2.62 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |