C18H27NO4S — CID 136550700
5-methyl-4-[[4-(oxan-2-ylmethoxy)piperidin-1-yl]methyl]thiophene-2-carboxylic acid (PubChem CID 136550700) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 5-methyl-4-[[4-(oxan-2-ylmethoxy)piperidin-1-yl]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-[[4-(oxan-2-ylmethoxy)piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 136550700 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 5-methyl-4-[[4-(oxan-2-ylmethoxy)piperidin-1-yl]methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CN1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C18H27NO4S/c1-13-14(10-17(24-13)18(20)21)11-19-7-5-15(6-8-19)23-12-16-4-2-3-9-22-16/h10,15-16H,2-9,11-12H2,1H3,(H,20,21) |
| InChIKey | CVTAKLRVDKJYJA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |