C17H29NO4 — CID 126777502
1-[4-(oxan-2-ylmethoxy)piperidin-1-yl]hexane-1,5-dione (PubChem CID 126777502) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 1-[4-(oxan-2-ylmethoxy)piperidin-1-yl]hexane-1,5-dione.
| Compound Name | 1-[4-(oxan-2-ylmethoxy)piperidin-1-yl]hexane-1,5-dione |
|---|---|
| PubChem CID | 126777502 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1-[4-(oxan-2-ylmethoxy)piperidin-1-yl]hexane-1,5-dione |
| SMILES | CC(=O)CCCC(=O)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C17H29NO4/c1-14(19)5-4-7-17(20)18-10-8-15(9-11-18)22-13-16-6-2-3-12-21-16/h15-16H,2-13H2,1H3 |
| InChIKey | ZEYSYFPTKVGOED-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |