C18H32N2O3 — CID 119341879
(1-aminocyclohexyl)-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methanone (PubChem CID 119341879) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is (1-aminocyclohexyl)-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methanone.
| Compound Name | (1-aminocyclohexyl)-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119341879 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | (1-aminocyclohexyl)-[4-(oxan-2-ylmethoxy)piperidin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCC(OCC3CCCCO3)CC2)CCCCC1 |
| InChI | InChI=1S/C18H32N2O3/c19-18(9-3-1-4-10-18)17(21)20-11-7-15(8-12-20)23-14-16-6-2-5-13-22-16/h15-16H,1-14,19H2 |
| InChIKey | KGKCLUKOQWRSOO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |