C15H27NO4 — CID 124609824
methyl (2S)-2-[4-[[(2R)-oxan-2-yl]methoxy]piperidin-1-yl]propanoate (PubChem CID 124609824) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is methyl (2S)-2-[4-[[(2R)-oxan-2-yl]methoxy]piperidin-1-yl]propanoate.
| Compound Name | methyl (2S)-2-[4-[[(2R)-oxan-2-yl]methoxy]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 124609824 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | methyl (2S)-2-[4-[[(2R)-oxan-2-yl]methoxy]piperidin-1-yl]propanoate |
| SMILES | COC(=O)[C@H](C)N1CCC(OC[C@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C15H27NO4/c1-12(15(17)18-2)16-8-6-13(7-9-16)20-11-14-5-3-4-10-19-14/h12-14H,3-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | KBZZVAKWIVUAPK-GXTWGEPZSA-N |
| XLogP | 1.60 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |