C17H29N5O2 — CID 124623738
1-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine (PubChem CID 124623738) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine.
| Compound Name | 1-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine |
|---|---|
| PubChem CID | 124623738 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine |
| SMILES | C[C@H](c1nnnn1C1CC1)N1CCC(OC[C@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C17H29N5O2/c1-13(17-18-19-20-22(17)14-5-6-14)21-9-7-15(8-10-21)24-12-16-4-2-3-11-23-16/h13-16H,2-12H2,1H3/t13-,16-/m1/s1 |
| InChIKey | CIOZFQXCPYEKNL-CZUORRHYSA-N |
| XLogP | 2.12 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |