C20H31NO3 — CID 96558685
1-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine (PubChem CID 96558685) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 1-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine.
| Compound Name | 1-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine |
|---|---|
| PubChem CID | 96558685 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-[(1S)-1-(3-methoxyphenyl)ethyl]-4-[[(2R)-oxan-2-yl]methoxy]piperidine |
| SMILES | COc1cccc([C@H](C)N2CCC(OC[C@H]3CCCCO3)CC2)c1 |
| InChI | InChI=1S/C20H31NO3/c1-16(17-6-5-8-19(14-17)22-2)21-11-9-18(10-12-21)24-15-20-7-3-4-13-23-20/h5-6,8,14,16,18,20H,3-4,7,9-13,15H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | QVRXCZLSNFYLMN-OXJNMPFZSA-N |
| XLogP | 3.81 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |