C18H27N5O2 — CID 100673992
(2S)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-(5-methylfuran-2-yl)morpholine (PubChem CID 100673992) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (2S)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-(5-methylfuran-2-yl)morpholine.
| Compound Name | (2S)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-(5-methylfuran-2-yl)morpholine |
|---|---|
| PubChem CID | 100673992 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (2S)-4-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-(5-methylfuran-2-yl)morpholine |
| SMILES | Cc1ccc([C@@H]2CN([C@H](C)c3nnnn3C3CCCCC3)CCO2)o1 |
| InChI | InChI=1S/C18H27N5O2/c1-13-8-9-16(25-13)17-12-22(10-11-24-17)14(2)18-19-20-21-23(18)15-6-4-3-5-7-15/h8-9,14-15,17H,3-7,10-12H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | QVUONFLZVMXHET-PBHICJAKSA-N |
| XLogP | 3.21 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |