C16H30N6O — CID 124864640
2-[(2R)-4-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-methylpiperazin-1-yl]ethanol (PubChem CID 124864640) has the molecular formula C16H30N6O and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-[(2R)-4-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-methylpiperazin-1-yl]ethanol.
| Compound Name | 2-[(2R)-4-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-methylpiperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 124864640 |
| Molecular Formula | C16H30N6O |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2-[(2R)-4-[(1S)-1-(1-cyclohexyltetrazol-5-yl)ethyl]-2-methylpiperazin-1-yl]ethanol |
| SMILES | C[C@@H]1CN([C@@H](C)c2nnnn2C2CCCCC2)CCN1CCO |
| InChI | InChI=1S/C16H30N6O/c1-13-12-21(9-8-20(13)10-11-23)14(2)16-17-18-19-22(16)15-6-4-3-5-7-15/h13-15,23H,3-12H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | ZKSASEAYAOFYIA-KGLIPLIRSA-N |
| XLogP | 1.24 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |