C22H32N2O4 — CID 99814762
[2-(morpholin-4-ylmethyl)phenyl]-[4-[[(2S)-oxolan-2-yl]methoxy]piperidin-1-yl]methanone (PubChem CID 99814762) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [2-(morpholin-4-ylmethyl)phenyl]-[4-[[(2S)-oxolan-2-yl]methoxy]piperidin-1-yl]methanone.
| Compound Name | [2-(morpholin-4-ylmethyl)phenyl]-[4-[[(2S)-oxolan-2-yl]methoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 99814762 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [2-(morpholin-4-ylmethyl)phenyl]-[4-[[(2S)-oxolan-2-yl]methoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1CN1CCOCC1)N1CCC(OC[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C22H32N2O4/c25-22(21-6-2-1-4-18(21)16-23-11-14-26-15-12-23)24-9-7-19(8-10-24)28-17-20-5-3-13-27-20/h1-2,4,6,19-20H,3,5,7-17H2/t20-/m0/s1 |
| InChIKey | QXIZVEAERSHFOS-FQEVSTJZSA-N |
| XLogP | 2.32 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |