C21H30N4 — CID 124619726
N-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-phenylethyl)piperidin-4-amine (PubChem CID 124619726) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-phenylethyl)piperidin-4-amine.
| Compound Name | N-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-phenylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 124619726 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | N-[(R)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-phenylethyl)piperidin-4-amine |
| SMILES | Cn1ccnc1[C@H](NC1CCN(CCc2ccccc2)CC1)C1CC1 |
| InChI | InChI=1S/C21H30N4/c1-24-16-12-22-21(24)20(18-7-8-18)23-19-10-14-25(15-11-19)13-9-17-5-3-2-4-6-17/h2-6,12,16,18-20,23H,7-11,13-15H2,1H3/t20-/m1/s1 |
| InChIKey | XJHZDMIGOLFKPU-HXUWFJFHSA-N |
| XLogP | 3.17 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |