C19H25FN4 — CID 125437238
N-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-fluorophenyl)piperidin-4-amine (PubChem CID 125437238) has the molecular formula C19H25FN4 and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-fluorophenyl)piperidin-4-amine.
| Compound Name | N-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-fluorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 125437238 |
| Molecular Formula | C19H25FN4 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | N-[(S)-cyclopropyl-(1-methylimidazol-2-yl)methyl]-1-(2-fluorophenyl)piperidin-4-amine |
| SMILES | Cn1ccnc1[C@@H](NC1CCN(c2ccccc2F)CC1)C1CC1 |
| InChI | InChI=1S/C19H25FN4/c1-23-13-10-21-19(23)18(14-6-7-14)22-15-8-11-24(12-9-15)17-5-3-2-4-16(17)20/h2-5,10,13-15,18,22H,6-9,11-12H2,1H3/t18-/m0/s1 |
| InChIKey | FBIOAKVFMPGJMN-SFHVURJKSA-N |
| XLogP | 3.27 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |