C19H24FN3 — CID 95188661
1-(2-fluorophenyl)-N-[(1S)-1-pyridin-2-ylpropyl]piperidin-4-amine (PubChem CID 95188661) has the molecular formula C19H24FN3 and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[(1S)-1-pyridin-2-ylpropyl]piperidin-4-amine.
| Compound Name | 1-(2-fluorophenyl)-N-[(1S)-1-pyridin-2-ylpropyl]piperidin-4-amine |
|---|---|
| PubChem CID | 95188661 |
| Molecular Formula | C19H24FN3 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[(1S)-1-pyridin-2-ylpropyl]piperidin-4-amine |
| SMILES | CC[C@H](NC1CCN(c2ccccc2F)CC1)c1ccccn1 |
| InChI | InChI=1S/C19H24FN3/c1-2-17(18-8-5-6-12-21-18)22-15-10-13-23(14-11-15)19-9-4-3-7-16(19)20/h3-9,12,15,17,22H,2,10-11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | BCAIAWPBBIXWRN-KRWDZBQOSA-N |
| XLogP | 3.93 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |