C19H18F2N2O3 — CID 124620018
(3R)-4-[4-(2,4-difluorophenoxy)benzoyl]-3-methyl-1,4-diazepan-2-one (PubChem CID 124620018) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is (3R)-4-[4-(2,4-difluorophenoxy)benzoyl]-3-methyl-1,4-diazepan-2-one.
| Compound Name | (3R)-4-[4-(2,4-difluorophenoxy)benzoyl]-3-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 124620018 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3R)-4-[4-(2,4-difluorophenoxy)benzoyl]-3-methyl-1,4-diazepan-2-one |
| SMILES | C[C@@H]1C(=O)NCCCN1C(=O)c1ccc(Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H18F2N2O3/c1-12-18(24)22-9-2-10-23(12)19(25)13-3-6-15(7-4-13)26-17-8-5-14(20)11-16(17)21/h3-8,11-12H,2,9-10H2,1H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | MWZWCCYSNBYWLY-GFCCVEGCSA-N |
| XLogP | 3.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |