C19H25N3O3 — CID 124620055
(3R,4S)-3-methyl-4-morpholin-4-yl-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 124620055) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3R,4S)-3-methyl-4-morpholin-4-yl-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (3R,4S)-3-methyl-4-morpholin-4-yl-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 124620055 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (3R,4S)-3-methyl-4-morpholin-4-yl-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | C#CCOc1ccccc1NC(=O)N1C[C@@H](C)[C@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-3-10-25-18-7-5-4-6-16(18)20-19(23)22-13-15(2)17(14-22)21-8-11-24-12-9-21/h1,4-7,15,17H,8-14H2,2H3,(H,20,23)/t15-,17-/m1/s1 |
| InChIKey | VNYFSVYXTRCQTF-NVXWUHKLSA-N |
| XLogP | 1.88 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|