C20H27N3O2 — CID 99826625
(3S)-3-(piperidin-1-ylmethyl)-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 99826625) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (3S)-3-(piperidin-1-ylmethyl)-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-(piperidin-1-ylmethyl)-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99826625 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3S)-3-(piperidin-1-ylmethyl)-N-(2-prop-2-ynoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | C#CCOc1ccccc1NC(=O)N1CC[C@@H](CN2CCCCC2)C1 |
| InChI | InChI=1S/C20H27N3O2/c1-2-14-25-19-9-5-4-8-18(19)21-20(24)23-13-10-17(16-23)15-22-11-6-3-7-12-22/h1,4-5,8-9,17H,3,6-7,10-16H2,(H,21,24)/t17-/m0/s1 |
| InChIKey | JGCNJQBMUONCRX-KRWDZBQOSA-N |
| XLogP | 3.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|