C15H26N4O2S — CID 124621844
(3S)-N-[1-[(2S)-1-methoxypropan-2-yl]pyrazol-3-yl]-3-methylsulfanylazepane-1-carboxamide (PubChem CID 124621844) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is (3S)-N-[1-[(2S)-1-methoxypropan-2-yl]pyrazol-3-yl]-3-methylsulfanylazepane-1-carboxamide.
| Compound Name | (3S)-N-[1-[(2S)-1-methoxypropan-2-yl]pyrazol-3-yl]-3-methylsulfanylazepane-1-carboxamide |
|---|---|
| PubChem CID | 124621844 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (3S)-N-[1-[(2S)-1-methoxypropan-2-yl]pyrazol-3-yl]-3-methylsulfanylazepane-1-carboxamide |
| SMILES | COC[C@H](C)n1ccc(NC(=O)N2CCCC[C@H](SC)C2)n1 |
| InChI | InChI=1S/C15H26N4O2S/c1-12(11-21-2)19-9-7-14(17-19)16-15(20)18-8-5-4-6-13(10-18)22-3/h7,9,12-13H,4-6,8,10-11H2,1-3H3,(H,16,17,20)/t12-,13-/m0/s1 |
| InChIKey | HQVXBQUXDNUUEK-STQMWFEESA-N |
| XLogP | 2.84 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |