C17H27N3O2S — CID 124621953
(3R)-N-cyclopentyl-1-[(5-methyl-3-pyridinyl)methyl]piperidine-3-sulfonamide (PubChem CID 124621953) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is (3R)-N-cyclopentyl-1-[(5-methyl-3-pyridinyl)methyl]piperidine-3-sulfonamide.
| Compound Name | (3R)-N-cyclopentyl-1-[(5-methyl-3-pyridinyl)methyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 124621953 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (3R)-N-cyclopentyl-1-[(5-methyl-3-pyridinyl)methyl]piperidine-3-sulfonamide |
| SMILES | Cc1cncc(CN2CCC[C@@H](S(=O)(=O)NC3CCCC3)C2)c1 |
| InChI | InChI=1S/C17H27N3O2S/c1-14-9-15(11-18-10-14)12-20-8-4-7-17(13-20)23(21,22)19-16-5-2-3-6-16/h9-11,16-17,19H,2-8,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | DXFZDDWKJHIZCI-QGZVFWFLSA-N |
| XLogP | 2.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |