C15H25N5O2S — CID 124616923
(3R)-1-[(4-aminopyrimidin-2-yl)methyl]-N-cyclopentylpiperidine-3-sulfonamide (PubChem CID 124616923) has the molecular formula C15H25N5O2S and a molecular weight of 339.47 g/mol. Its IUPAC name is (3R)-1-[(4-aminopyrimidin-2-yl)methyl]-N-cyclopentylpiperidine-3-sulfonamide.
| Compound Name | (3R)-1-[(4-aminopyrimidin-2-yl)methyl]-N-cyclopentylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 124616923 |
| Molecular Formula | C15H25N5O2S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3R)-1-[(4-aminopyrimidin-2-yl)methyl]-N-cyclopentylpiperidine-3-sulfonamide |
| SMILES | Nc1ccnc(CN2CCC[C@@H](S(=O)(=O)NC3CCCC3)C2)n1 |
| InChI | InChI=1S/C15H25N5O2S/c16-14-7-8-17-15(18-14)11-20-9-3-6-13(10-20)23(21,22)19-12-4-1-2-5-12/h7-8,12-13,19H,1-6,9-11H2,(H2,16,17,18)/t13-/m1/s1 |
| InChIKey | JXTFQNXAPZFZDV-CYBMUJFWSA-N |
| XLogP | 0.89 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |