C15H24N4O3S — CID 124736119
(3S)-N-cyclopentyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-sulfonamide (PubChem CID 124736119) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is (3S)-N-cyclopentyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-sulfonamide.
| Compound Name | (3S)-N-cyclopentyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 124736119 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (3S)-N-cyclopentyl-1-(4-methoxypyrimidin-2-yl)piperidine-3-sulfonamide |
| SMILES | COc1ccnc(N2CCC[C@H](S(=O)(=O)NC3CCCC3)C2)n1 |
| InChI | InChI=1S/C15H24N4O3S/c1-22-14-8-9-16-15(17-14)19-10-4-7-13(11-19)23(20,21)18-12-5-2-3-6-12/h8-9,12-13,18H,2-7,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | ORYVASFBKYFJQA-ZDUSSCGKSA-N |
| XLogP | 1.32 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |