C17H23N5O2S — CID 97348278
(3S)-N-cyclopentyl-1-pyrido[2,3-b]pyrazin-6-ylpiperidine-3-sulfonamide (PubChem CID 97348278) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is (3S)-N-cyclopentyl-1-pyrido[2,3-b]pyrazin-6-ylpiperidine-3-sulfonamide.
| Compound Name | (3S)-N-cyclopentyl-1-pyrido[2,3-b]pyrazin-6-ylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348278 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (3S)-N-cyclopentyl-1-pyrido[2,3-b]pyrazin-6-ylpiperidine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)[C@H]1CCCN(c2ccc3nccnc3n2)C1 |
| InChI | InChI=1S/C17H23N5O2S/c23-25(24,21-13-4-1-2-5-13)14-6-3-11-22(12-14)16-8-7-15-17(20-16)19-10-9-18-15/h7-10,13-14,21H,1-6,11-12H2/t14-/m0/s1 |
| InChIKey | VHUKVLAVSIDLNY-AWEZNQCLSA-N |
| XLogP | 1.86 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |