C18H22Cl2N4O2S — CID 133463706
N-cyclopentyl-1-(6,7-dichloroquinoxalin-2-yl)piperidine-3-sulfonamide (PubChem CID 133463706) has the molecular formula C18H22Cl2N4O2S and a molecular weight of 429.37 g/mol. Its IUPAC name is N-cyclopentyl-1-(6,7-dichloroquinoxalin-2-yl)piperidine-3-sulfonamide.
| Compound Name | N-cyclopentyl-1-(6,7-dichloroquinoxalin-2-yl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 133463706 |
| Molecular Formula | C18H22Cl2N4O2S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-cyclopentyl-1-(6,7-dichloroquinoxalin-2-yl)piperidine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)C1CCCN(c2cnc3cc(Cl)c(Cl)cc3n2)C1 |
| InChI | InChI=1S/C18H22Cl2N4O2S/c19-14-8-16-17(9-15(14)20)22-18(10-21-16)24-7-3-6-13(11-24)27(25,26)23-12-4-1-2-5-12/h8-10,12-13,23H,1-7,11H2 |
| InChIKey | KDBASMHSLCIXGU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |