C14H13F2N3O2 — CID 122051206
1-(6,7-difluoroquinoxalin-2-yl)piperidine-3-carboxylic acid (PubChem CID 122051206) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is 1-(6,7-difluoroquinoxalin-2-yl)piperidine-3-carboxylic acid.
| Compound Name | 1-(6,7-difluoroquinoxalin-2-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122051206 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(6,7-difluoroquinoxalin-2-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(c2cnc3cc(F)c(F)cc3n2)C1 |
| InChI | InChI=1S/C14H13F2N3O2/c15-9-4-11-12(5-10(9)16)18-13(6-17-11)19-3-1-2-8(7-19)14(20)21/h4-6,8H,1-3,7H2,(H,20,21) |
| InChIKey | DEYMAQIZMWGTOZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |