C19H22FN3O2 — CID 56767542
1-[2-(4-fluorophenyl)-6-propylpyrimidin-4-yl]piperidine-3-carboxylic acid (PubChem CID 56767542) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-6-propylpyrimidin-4-yl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-(4-fluorophenyl)-6-propylpyrimidin-4-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 56767542 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-6-propylpyrimidin-4-yl]piperidine-3-carboxylic acid |
| SMILES | CCCc1cc(N2CCCC(C(=O)O)C2)nc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H22FN3O2/c1-2-4-16-11-17(23-10-3-5-14(12-23)19(24)25)22-18(21-16)13-6-8-15(20)9-7-13/h6-9,11,14H,2-5,10,12H2,1H3,(H,24,25) |
| InChIKey | RLVXHZYNBICHOP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |