C15H18Cl2N4 — CID 129409920
6,7-dichloro-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline (PubChem CID 129409920) has the molecular formula C15H18Cl2N4 and a molecular weight of 325.24 g/mol. Its IUPAC name is 6,7-dichloro-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline.
| Compound Name | 6,7-dichloro-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 129409920 |
| Molecular Formula | C15H18Cl2N4 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 6,7-dichloro-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline |
| SMILES | CC(C)[C@@H]1CN(c2cnc3cc(Cl)c(Cl)cc3n2)CCN1 |
| InChI | InChI=1S/C15H18Cl2N4/c1-9(2)14-8-21(4-3-18-14)15-7-19-12-5-10(16)11(17)6-13(12)20-15/h5-7,9,14,18H,3-4,8H2,1-2H3/t14-/m0/s1 |
| InChIKey | KJQIYKFGEGQONM-AWEZNQCLSA-N |
| XLogP | 3.37 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |