C17H24N4 — CID 129409860
6,7-dimethyl-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline (PubChem CID 129409860) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 6,7-dimethyl-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline.
| Compound Name | 6,7-dimethyl-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 129409860 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 6,7-dimethyl-2-[(3R)-3-propan-2-ylpiperazin-1-yl]quinoxaline |
| SMILES | Cc1cc2ncc(N3CCN[C@H](C(C)C)C3)nc2cc1C |
| InChI | InChI=1S/C17H24N4/c1-11(2)16-10-21(6-5-18-16)17-9-19-14-7-12(3)13(4)8-15(14)20-17/h7-9,11,16,18H,5-6,10H2,1-4H3/t16-/m0/s1 |
| InChIKey | UYTHEVHWEGOIQC-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |