C16H19F3N4 — CID 129409832
2-[(3R)-3-propan-2-ylpiperazin-1-yl]-8-(trifluoromethyl)quinoxaline (PubChem CID 129409832) has the molecular formula C16H19F3N4 and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-[(3R)-3-propan-2-ylpiperazin-1-yl]-8-(trifluoromethyl)quinoxaline.
| Compound Name | 2-[(3R)-3-propan-2-ylpiperazin-1-yl]-8-(trifluoromethyl)quinoxaline |
|---|---|
| PubChem CID | 129409832 |
| Molecular Formula | C16H19F3N4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[(3R)-3-propan-2-ylpiperazin-1-yl]-8-(trifluoromethyl)quinoxaline |
| SMILES | CC(C)[C@@H]1CN(c2cnc3cccc(C(F)(F)F)c3n2)CCN1 |
| InChI | InChI=1S/C16H19F3N4/c1-10(2)13-9-23(7-6-20-13)14-8-21-12-5-3-4-11(15(12)22-14)16(17,18)19/h3-5,8,10,13,20H,6-7,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZQAVRCXNXFDDHB-ZDUSSCGKSA-N |
| XLogP | 3.08 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |