C15H20N4 — CID 129391744
2-[(3R)-3-propan-2-ylpiperazin-1-yl]-1,8-naphthyridine (PubChem CID 129391744) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[(3R)-3-propan-2-ylpiperazin-1-yl]-1,8-naphthyridine.
| Compound Name | 2-[(3R)-3-propan-2-ylpiperazin-1-yl]-1,8-naphthyridine |
|---|---|
| PubChem CID | 129391744 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-[(3R)-3-propan-2-ylpiperazin-1-yl]-1,8-naphthyridine |
| SMILES | CC(C)[C@@H]1CN(c2ccc3cccnc3n2)CCN1 |
| InChI | InChI=1S/C15H20N4/c1-11(2)13-10-19(9-8-16-13)14-6-5-12-4-3-7-17-15(12)18-14/h3-7,11,13,16H,8-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | UJAGXVVDBSPRNB-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |