C15H21N5O4S — CID 167288482
6,7-dimethoxy-2-[4-(sulfamoylamino)piperidin-1-yl]quinoxaline (PubChem CID 167288482) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[4-(sulfamoylamino)piperidin-1-yl]quinoxaline.
| Compound Name | 6,7-dimethoxy-2-[4-(sulfamoylamino)piperidin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 167288482 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 6,7-dimethoxy-2-[4-(sulfamoylamino)piperidin-1-yl]quinoxaline |
| SMILES | COc1cc2ncc(N3CCC(NS(N)(=O)=O)CC3)nc2cc1OC |
| InChI | InChI=1S/C15H21N5O4S/c1-23-13-7-11-12(8-14(13)24-2)18-15(9-17-11)20-5-3-10(4-6-20)19-25(16,21)22/h7-10,19H,3-6H2,1-2H3,(H2,16,21,22) |
| InChIKey | KLVHRGZDAYGVFI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |