C16H21N5O3S — CID 167966554
4-(4-methoxyphenyl)-6-[4-(sulfamoylamino)piperidin-1-yl]pyrimidine (PubChem CID 167966554) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-[4-(sulfamoylamino)piperidin-1-yl]pyrimidine.
| Compound Name | 4-(4-methoxyphenyl)-6-[4-(sulfamoylamino)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 167966554 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-[4-(sulfamoylamino)piperidin-1-yl]pyrimidine |
| SMILES | COc1ccc(-c2cc(N3CCC(NS(N)(=O)=O)CC3)ncn2)cc1 |
| InChI | InChI=1S/C16H21N5O3S/c1-24-14-4-2-12(3-5-14)15-10-16(19-11-18-15)21-8-6-13(7-9-21)20-25(17,22)23/h2-5,10-11,13,20H,6-9H2,1H3,(H2,17,22,23) |
| InChIKey | XRHKMRFJNWEMPJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |