C18H22ClN3O4S — CID 171682723
N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 171682723) has the molecular formula C18H22ClN3O4S and a molecular weight of 411.91 g/mol. Its IUPAC name is N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 171682723 |
| Molecular Formula | C18H22ClN3O4S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-[1-(3-chloro-2-pyridinyl)piperidin-4-yl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCN(c3ncccc3Cl)CC2)cc1OC |
| InChI | InChI=1S/C18H22ClN3O4S/c1-25-16-6-5-14(12-17(16)26-2)27(23,24)21-13-7-10-22(11-8-13)18-15(19)4-3-9-20-18/h3-6,9,12-13,21H,7-8,10-11H2,1-2H3 |
| InChIKey | YZEJQTWIOZJIEX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |