C13H15ClN4 — CID 102960882
6-(3-chloro-4-methylpiperidin-1-yl)pyrido[2,3-b]pyrazine (PubChem CID 102960882) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 6-(3-chloro-4-methylpiperidin-1-yl)pyrido[2,3-b]pyrazine.
| Compound Name | 6-(3-chloro-4-methylpiperidin-1-yl)pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 102960882 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 6-(3-chloro-4-methylpiperidin-1-yl)pyrido[2,3-b]pyrazine |
| SMILES | CC1CCN(c2ccc3nccnc3n2)CC1Cl |
| InChI | InChI=1S/C13H15ClN4/c1-9-4-7-18(8-10(9)14)12-3-2-11-13(17-12)16-6-5-15-11/h2-3,5-6,9-10H,4,7-8H2,1H3 |
| InChIKey | APBIOLLFZCNOEN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|