About 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine
6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine (PubChem CID 126891851) has the molecular formula C15H20N6
and a molecular weight of 284.37 g/mol. Its IUPAC name is 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine |
| PubChem CID | 126891851 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine |
| SMILES | CN1CCN(C2CN(c3ccc4nccnc4n3)C2)CC1 |
| InChI | InChI=1S/C15H20N6/c1-19-6-8-20(9-7-19)12-10-21(11-12)14-3-2-13-15(18-14)17-5-4-16-13/h2-5,12H,6-11H2,1H3 |
| InChIKey | PLCFOTLKLZXEFG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine?
The IUPAC name of 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine (CID 126891851) is 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine.
What is the SMILES notation for 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine?
The canonical SMILES for 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine is CN1CCN(C2CN(c3ccc4nccnc4n3)C2)CC1.
What is the InChIKey of 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine?
The InChIKey is PLCFOTLKLZXEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N6/c1-19-6-8-20(9-7-19)12-10-21(11-12)14-3-2-13-15(18-14)17-5-4-16-13/h2-5,12H,6-11H2,1H3.
What are the key properties of 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine?
6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine has a molecular weight of 284.37 g/mol, XLogP of 0.46, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4-methylpiperazin-1-yl)azetidin-1-yl]pyrido[2,3-b]pyrazine is sourced from PubChem (CID 126891851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).