C13H12N6 — CID 126900410
6-(3-pyrazol-1-ylazetidin-1-yl)pyrido[2,3-b]pyrazine (PubChem CID 126900410) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is 6-(3-pyrazol-1-ylazetidin-1-yl)pyrido[2,3-b]pyrazine.
| Compound Name | 6-(3-pyrazol-1-ylazetidin-1-yl)pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 126900410 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 6-(3-pyrazol-1-ylazetidin-1-yl)pyrido[2,3-b]pyrazine |
| SMILES | c1cnn(C2CN(c3ccc4nccnc4n3)C2)c1 |
| InChI | InChI=1S/C13H12N6/c1-4-16-19(7-1)10-8-18(9-10)12-3-2-11-13(17-12)15-6-5-14-11/h1-7,10H,8-9H2 |
| InChIKey | WKTWZDCCCNYOMF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |