C13H15FN4 — CID 133275758
2-fluoro-6-(3-pyrazol-1-ylpiperidin-1-yl)pyridine (PubChem CID 133275758) has the molecular formula C13H15FN4 and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-fluoro-6-(3-pyrazol-1-ylpiperidin-1-yl)pyridine.
| Compound Name | 2-fluoro-6-(3-pyrazol-1-ylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 133275758 |
| Molecular Formula | C13H15FN4 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-fluoro-6-(3-pyrazol-1-ylpiperidin-1-yl)pyridine |
| SMILES | Fc1cccc(N2CCCC(n3cccn3)C2)n1 |
| InChI | InChI=1S/C13H15FN4/c14-12-5-1-6-13(16-12)17-8-2-4-11(10-17)18-9-3-7-15-18/h1,3,5-7,9,11H,2,4,8,10H2 |
| InChIKey | VHQFDYANFSIDSZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|