C16H17N7 — CID 133301788
N-(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-4-yl)pyridazin-3-amine (PubChem CID 133301788) has the molecular formula C16H17N7 and a molecular weight of 307.36 g/mol. Its IUPAC name is N-(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-4-yl)pyridazin-3-amine.
| Compound Name | N-(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-4-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133301788 |
| Molecular Formula | C16H17N7 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-4-yl)pyridazin-3-amine |
| SMILES | c1cnnc(NC2CCN(c3ccc4nccnc4n3)CC2)c1 |
| InChI | InChI=1S/C16H17N7/c1-2-14(22-19-7-1)20-12-5-10-23(11-6-12)15-4-3-13-16(21-15)18-9-8-17-13/h1-4,7-9,12H,5-6,10-11H2,(H,20,22) |
| InChIKey | UVIMNPQBSHVQBO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |