About 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol
3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol (PubChem CID 124622135) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol |
| PubChem CID | 124622135 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol |
| SMILES | Oc1cccc([C@@H]2CN(CC3CCC4(CC3)OCCO4)CCO2)c1 |
| InChI | InChI=1S/C19H27NO4/c21-17-3-1-2-16(12-17)18-14-20(8-9-22-18)13-15-4-6-19(7-5-15)23-10-11-24-19/h1-3,12,15,18,21H,4-11,13-14H2/t18-/m0/s1 |
| InChIKey | CLJFFXGASRBAJM-SFHVURJKSA-N |
| XLogP | 2.70 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol?
The IUPAC name of 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol (CID 124622135) is 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol.
What is the SMILES notation for 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol?
The canonical SMILES for 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol is Oc1cccc([C@@H]2CN(CC3CCC4(CC3)OCCO4)CCO2)c1.
What is the InChIKey of 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol?
The InChIKey is CLJFFXGASRBAJM-SFHVURJKSA-N. The full InChI is InChI=1S/C19H27NO4/c21-17-3-1-2-16(12-17)18-14-20(8-9-22-18)13-15-4-6-19(7-5-15)23-10-11-24-19/h1-3,12,15,18,21H,4-11,13-14H2/t18-/m0/s1.
What are the key properties of 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol?
3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol has a molecular weight of 333.43 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R)-4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)morpholin-2-yl]phenol is sourced from PubChem (CID 124622135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).