C13H17F2NO2 — CID 124623073
(2S)-2-[(2,6-difluorophenyl)methyl-ethylamino]butanoic acid (PubChem CID 124623073) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is (2S)-2-[(2,6-difluorophenyl)methyl-ethylamino]butanoic acid.
| Compound Name | (2S)-2-[(2,6-difluorophenyl)methyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 124623073 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2S)-2-[(2,6-difluorophenyl)methyl-ethylamino]butanoic acid |
| SMILES | CC[C@@H](C(=O)O)N(CC)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2NO2/c1-3-12(13(17)18)16(4-2)8-9-10(14)6-5-7-11(9)15/h5-7,12H,3-4,8H2,1-2H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | ZWFASWDLNVGCMS-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |