C16H19N3OS2 — CID 124623910
[(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]-(2-methylsulfanylphenyl)methanone (PubChem CID 124623910) has the molecular formula C16H19N3OS2 and a molecular weight of 333.48 g/mol. Its IUPAC name is [(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]-(2-methylsulfanylphenyl)methanone.
| Compound Name | [(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]-(2-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 124623910 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]-(2-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccccc1C(=O)N1CCSC[C@@H]1c1cnn(C)c1 |
| InChI | InChI=1S/C16H19N3OS2/c1-18-10-12(9-17-18)14-11-22-8-7-19(14)16(20)13-5-3-4-6-15(13)21-2/h3-6,9-10,14H,7-8,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | VJYYLUJHAWVPBI-CQSZACIVSA-N |
| XLogP | 3.07 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_thiomorph_Z(1)', 'substructure': 'N/A'} |
|---|