C16H27N5O — CID 124624996
5-[[(4aR,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 124624996) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is 5-[[(4aR,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[[(4aR,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 124624996 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 5-[[(4aR,8aS)-1-cyclopropyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]methyl]-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(CN2CC[C@H]3[C@H](CCCN3C3CC3)C2)n1 |
| InChI | InChI=1S/C16H27N5O/c1-19(2)16-17-15(22-18-16)11-20-9-7-14-12(10-20)4-3-8-21(14)13-5-6-13/h12-14H,3-11H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | WNTDWZZXCYAUBK-OCCSQVGLSA-N |
| XLogP | 1.58 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |