C13H20N6S — CID 124625428
1-[(2-methyltetrazol-5-yl)methyl]-4-[(1R)-1-thiophen-3-ylethyl]piperazine (PubChem CID 124625428) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-[(2-methyltetrazol-5-yl)methyl]-4-[(1R)-1-thiophen-3-ylethyl]piperazine.
| Compound Name | 1-[(2-methyltetrazol-5-yl)methyl]-4-[(1R)-1-thiophen-3-ylethyl]piperazine |
|---|---|
| PubChem CID | 124625428 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[(2-methyltetrazol-5-yl)methyl]-4-[(1R)-1-thiophen-3-ylethyl]piperazine |
| SMILES | C[C@H](c1ccsc1)N1CCN(Cc2nnn(C)n2)CC1 |
| InChI | InChI=1S/C13H20N6S/c1-11(12-3-8-20-10-12)19-6-4-18(5-7-19)9-13-14-16-17(2)15-13/h3,8,10-11H,4-7,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | IQVMKQNIKCSCNP-LLVKDONJSA-N |
| XLogP | 1.15 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |