C18H22N2O2S — CID 122032905
3-[[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methyl]benzoic acid (PubChem CID 122032905) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 3-[[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122032905 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-[[4-(1-thiophen-3-ylethyl)piperazin-1-yl]methyl]benzoic acid |
| SMILES | CC(c1ccsc1)N1CCN(Cc2cccc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C18H22N2O2S/c1-14(17-5-10-23-13-17)20-8-6-19(7-9-20)12-15-3-2-4-16(11-15)18(21)22/h2-5,10-11,13-14H,6-9,12H2,1H3,(H,21,22) |
| InChIKey | ZAFPMXIKQPMEBP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |