C17H28N4O2 — CID 124625483
(3R)-N-methyl-N-[2-[(2R)-oxan-2-yl]oxyethyl]-1-pyridazin-3-ylpiperidin-3-amine (PubChem CID 124625483) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is (3R)-N-methyl-N-[2-[(2R)-oxan-2-yl]oxyethyl]-1-pyridazin-3-ylpiperidin-3-amine.
| Compound Name | (3R)-N-methyl-N-[2-[(2R)-oxan-2-yl]oxyethyl]-1-pyridazin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 124625483 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (3R)-N-methyl-N-[2-[(2R)-oxan-2-yl]oxyethyl]-1-pyridazin-3-ylpiperidin-3-amine |
| SMILES | CN(CCO[C@@H]1CCCCO1)[C@@H]1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-20(11-13-23-17-8-2-3-12-22-17)15-6-5-10-21(14-15)16-7-4-9-18-19-16/h4,7,9,15,17H,2-3,5-6,8,10-14H2,1H3/t15-,17-/m1/s1 |
| InChIKey | RQDYGXCCFXJZHB-NVXWUHKLSA-N |
| XLogP | 1.92 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |