C15H22N6 — CID 95336321
(3R)-N-methyl-N-(2-pyrazol-1-ylethyl)-1-pyridazin-3-ylpiperidin-3-amine (PubChem CID 95336321) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is (3R)-N-methyl-N-(2-pyrazol-1-ylethyl)-1-pyridazin-3-ylpiperidin-3-amine.
| Compound Name | (3R)-N-methyl-N-(2-pyrazol-1-ylethyl)-1-pyridazin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 95336321 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3R)-N-methyl-N-(2-pyrazol-1-ylethyl)-1-pyridazin-3-ylpiperidin-3-amine |
| SMILES | CN(CCn1cccn1)[C@@H]1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C15H22N6/c1-19(11-12-21-10-4-8-17-21)14-5-3-9-20(13-14)15-6-2-7-16-18-15/h2,4,6-8,10,14H,3,5,9,11-13H2,1H3/t14-/m1/s1 |
| InChIKey | RFKMECKYMHKUKA-CQSZACIVSA-N |
| XLogP | 1.27 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |