C16H26N8 — CID 95600027
(3R)-N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-pyridazin-3-ylpiperidin-3-amine (PubChem CID 95600027) has the molecular formula C16H26N8 and a molecular weight of 330.44 g/mol. Its IUPAC name is (3R)-N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-pyridazin-3-ylpiperidin-3-amine.
| Compound Name | (3R)-N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-pyridazin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 95600027 |
| Molecular Formula | C16H26N8 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (3R)-N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-pyridazin-3-ylpiperidin-3-amine |
| SMILES | CCCCn1nnnc1CN(C)[C@@H]1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C16H26N8/c1-3-4-11-24-16(19-20-21-24)13-22(2)14-7-6-10-23(12-14)15-8-5-9-17-18-15/h5,8-9,14H,3-4,6-7,10-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | PWMFDEOLIYJVAA-CQSZACIVSA-N |
| XLogP | 1.36 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |