C17H28N8 — CID 56778163
N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-(6-methylpyridazin-3-yl)piperidin-3-amine (PubChem CID 56778163) has the molecular formula C17H28N8 and a molecular weight of 344.47 g/mol. Its IUPAC name is N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-(6-methylpyridazin-3-yl)piperidin-3-amine.
| Compound Name | N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-(6-methylpyridazin-3-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 56778163 |
| Molecular Formula | C17H28N8 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | N-[(1-butyltetrazol-5-yl)methyl]-N-methyl-1-(6-methylpyridazin-3-yl)piperidin-3-amine |
| SMILES | CCCCn1nnnc1CN(C)C1CCCN(c2ccc(C)nn2)C1 |
| InChI | InChI=1S/C17H28N8/c1-4-5-11-25-17(20-21-22-25)13-23(3)15-7-6-10-24(12-15)16-9-8-14(2)18-19-16/h8-9,15H,4-7,10-13H2,1-3H3 |
| InChIKey | SYCBIJCVZIPBNL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |