C12H15BrO3S — CID 124627526
(2R)-2-[[(R)-(5-bromo-2-methoxyphenyl)sulfinyl]methyl]oxolane (PubChem CID 124627526) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is (2R)-2-[[(R)-(5-bromo-2-methoxyphenyl)sulfinyl]methyl]oxolane.
| Compound Name | (2R)-2-[[(R)-(5-bromo-2-methoxyphenyl)sulfinyl]methyl]oxolane |
|---|---|
| PubChem CID | 124627526 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | (2R)-2-[[(R)-(5-bromo-2-methoxyphenyl)sulfinyl]methyl]oxolane |
| SMILES | COc1ccc(Br)cc1[S@](=O)C[C@H]1CCCO1 |
| InChI | InChI=1S/C12H15BrO3S/c1-15-11-5-4-9(13)7-12(11)17(14)8-10-3-2-6-16-10/h4-5,7,10H,2-3,6,8H2,1H3/t10-,17-/m1/s1 |
| InChIKey | DVCQIWZXQOJCIR-BMLIUANNSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |